Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Lithium carbonate, 99+%, ACS reagent
CAS: 554-13-2 Molecular Formula: CLi2O3 Molecular Weight (g/mol): 73.89 MDL Number: MFCD00011084 InChI Key: XGZVUEUWXADBQD-UHFFFAOYSA-L Synonym: lithium carbonate,dilithium carbonate,lithonate,lithobid,lithane,eskalith,lithotabs,carbonic acid lithium salt,liskonum,lithizine PubChem CID: 11125 ChEBI: CHEBI:6504 IUPAC Name: dilithium(1+) carbonate SMILES: [Li+].[Li+].[O-]C([O-])=O
| PubChem CID | 11125 |
|---|---|
| CAS | 554-13-2 |
| Molecular Weight (g/mol) | 73.89 |
| ChEBI | CHEBI:6504 |
| MDL Number | MFCD00011084 |
| SMILES | [Li+].[Li+].[O-]C([O-])=O |
| Synonym | lithium carbonate,dilithium carbonate,lithonate,lithobid,lithane,eskalith,lithotabs,carbonic acid lithium salt,liskonum,lithizine |
| IUPAC Name | dilithium(1+) carbonate |
| InChI Key | XGZVUEUWXADBQD-UHFFFAOYSA-L |
| Molecular Formula | CLi2O3 |
Scandium pieces, distilled dendritic, 99.9% (REO)
CAS: 7440-20-2 Molecular Formula: Sc Molecular Weight (g/mol): 44.96 MDL Number: MFCD00016323 InChI Key: SIXSYDAISGFNSX-UHFFFAOYSA-N Synonym: unii-yuj4u1ew7r,yuj4u1ew7r,escandio,skandium,atom,powder,ingot,nitrate solution,standard for aas,scandium, lump, vacuum remelted PubChem CID: 23952 ChEBI: CHEBI:33330 IUPAC Name: scandium SMILES: [Sc]
| PubChem CID | 23952 |
|---|---|
| CAS | 7440-20-2 |
| Molecular Weight (g/mol) | 44.96 |
| ChEBI | CHEBI:33330 |
| MDL Number | MFCD00016323 |
| SMILES | [Sc] |
| Synonym | unii-yuj4u1ew7r,yuj4u1ew7r,escandio,skandium,atom,powder,ingot,nitrate solution,standard for aas,scandium, lump, vacuum remelted |
| IUPAC Name | scandium |
| InChI Key | SIXSYDAISGFNSX-UHFFFAOYSA-N |
| Molecular Formula | Sc |
Neodymium foil, 0.1mm (0.004in) thick, 99.9% (REO)
CAS: 7440-00-8 Molecular Formula: Nd Molecular Weight (g/mol): 144.24 MDL Number: MFCD00011130 InChI Key: QEFYFXOXNSNQGX-UHFFFAOYSA-N Synonym: neodimio,neodyme,neodym,trihydride,ingot reo,neodymium, ion nd5+,atom,ingot,iii,foil, 3n PubChem CID: 23934 ChEBI: CHEBI:33372 IUPAC Name: neodymium SMILES: [Nd]
| PubChem CID | 23934 |
|---|---|
| CAS | 7440-00-8 |
| Molecular Weight (g/mol) | 144.24 |
| ChEBI | CHEBI:33372 |
| MDL Number | MFCD00011130 |
| SMILES | [Nd] |
| Synonym | neodimio,neodyme,neodym,trihydride,ingot reo,neodymium, ion nd5+,atom,ingot,iii,foil, 3n |
| IUPAC Name | neodymium |
| InChI Key | QEFYFXOXNSNQGX-UHFFFAOYSA-N |
| Molecular Formula | Nd |
Hexamethyldisilazane, Electronic grade, 99+%
CAS: 999-97-3 Molecular Formula: C6H19NSi2 MDL Number: MFCD00008259 InChI Key: FFUAGWLWBBFQJT-UHFFFAOYSA-N Synonym: hexamethyldisilazane,bis trimethylsilyl amine,hmds,1,1,1,3,3,3-hexamethyldisilazane,hexamethylsilazane,silanamine, 1,1,1-trimethyl-n-trimethylsilyl,tri-sil,1,1,1-trimethyl-n-trimethylsilyl silanamine,hexamethyldisilizane,disilazane, 1,1,1,3,3,3-hexamethyl PubChem CID: 13838 ChEBI: CHEBI:85068 IUPAC Name: [dimethyl-(trimethylsilylamino)silyl]methane SMILES: C[Si](C)(C)N[Si](C)(C)C
| PubChem CID | 13838 |
|---|---|
| CAS | 999-97-3 |
| ChEBI | CHEBI:85068 |
| MDL Number | MFCD00008259 |
| SMILES | C[Si](C)(C)N[Si](C)(C)C |
| Synonym | hexamethyldisilazane,bis trimethylsilyl amine,hmds,1,1,1,3,3,3-hexamethyldisilazane,hexamethylsilazane,silanamine, 1,1,1-trimethyl-n-trimethylsilyl,tri-sil,1,1,1-trimethyl-n-trimethylsilyl silanamine,hexamethyldisilizane,disilazane, 1,1,1,3,3,3-hexamethyl |
| IUPAC Name | [dimethyl-(trimethylsilylamino)silyl]methane |
| InChI Key | FFUAGWLWBBFQJT-UHFFFAOYSA-N |
| Molecular Formula | C6H19NSi2 |
| Name Note | 6.3mm (0.25 in.) dia. x 61cm (24 in.) long |
|---|---|
| Percent Purity | 99% |
| MDL Number | MFCD00144065 |
| Chemical Name or Material | Graphite rod |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |
| EINECS Number | 231-955-3 |
| Assay Percent Notes | (metals basis) |
| Weight | ≈40g/pc |
Mercuric acetate, 99+%
CAS: 1600-27-7 Molecular Formula: C4H6HgO4 Molecular Weight (g/mol): 318.67 MDL Number: MFCD00012165 InChI Key: BRMYZIKAHFEUFJ-UHFFFAOYSA-L Synonym: mercury 2+ ion acetic acid PubChem CID: 15337 ChEBI: CHEBI:33211 IUPAC Name: mercury(2+);diacetate SMILES: CC(=O)[O-].CC(=O)[O-].[Hg+2]
| PubChem CID | 15337 |
|---|---|
| CAS | 1600-27-7 |
| Molecular Weight (g/mol) | 318.67 |
| ChEBI | CHEBI:33211 |
| MDL Number | MFCD00012165 |
| SMILES | CC(=O)[O-].CC(=O)[O-].[Hg+2] |
| Synonym | mercury 2+ ion acetic acid |
| IUPAC Name | mercury(2+);diacetate |
| InChI Key | BRMYZIKAHFEUFJ-UHFFFAOYSA-L |
| Molecular Formula | C4H6HgO4 |
Hafnium powder, -325 mesh, 99.6% (metals basis excluding Zr), Zr <3.5%, Thermo Scientific Chemicals
CAS: 7440-58-6 Molecular Formula: Hf Molecular Weight (g/mol): 178.49 MDL Number: MFCD00011032 InChI Key: VBJZVLUMGGDVMO-UHFFFAOYSA-N Synonym: hafnium, elemental,hafnio,celtium,unii-x71938l1do,and compounds,hsdb 552,powder,foil,atom,wire PubChem CID: 23986 ChEBI: CHEBI:33343 IUPAC Name: hafnium SMILES: [Hf]
| PubChem CID | 23986 |
|---|---|
| CAS | 7440-58-6 |
| Molecular Weight (g/mol) | 178.49 |
| ChEBI | CHEBI:33343 |
| MDL Number | MFCD00011032 |
| SMILES | [Hf] |
| Synonym | hafnium, elemental,hafnio,celtium,unii-x71938l1do,and compounds,hsdb 552,powder,foil,atom,wire |
| IUPAC Name | hafnium |
| InChI Key | VBJZVLUMGGDVMO-UHFFFAOYSA-N |
| Molecular Formula | Hf |
11-Azidoundecyltrimethoxysilane, 94%
CAS: 334521-23-2 Molecular Formula: C14H31N3O3Si Molecular Weight (g/mol): 317.51 MDL Number: MFCD11982878 InChI Key: ACSJXAKDVNDMME-UHFFFAOYSA-N Synonym: 11-azidoundecyl trimethoxysilane,11-trimethoxysilyl undecyl azide PubChem CID: 46779110 SMILES: CO[Si](CCCCCCCCCCCN=[N+]=[N-])(OC)OC
| PubChem CID | 46779110 |
|---|---|
| CAS | 334521-23-2 |
| Molecular Weight (g/mol) | 317.51 |
| MDL Number | MFCD11982878 |
| SMILES | CO[Si](CCCCCCCCCCCN=[N+]=[N-])(OC)OC |
| Synonym | 11-azidoundecyl trimethoxysilane,11-trimethoxysilyl undecyl azide |
| InChI Key | ACSJXAKDVNDMME-UHFFFAOYSA-N |
| Molecular Formula | C14H31N3O3Si |
Titanium foil, 0.25mm (0.01in) thick, annealed, 99.5% (metals basis)
CAS: 7440-32-6 Molecular Formula: Ti Molecular Weight (g/mol): 47.87 MDL Number: MFCD00011264,MFCD00151301 InChI Key: RTAQQCXQSZGOHL-UHFFFAOYSA-N Synonym: oremet,alloy,cp,vt1,c.p.,contimet 30,jistp28,titanium-125,ii hydride,titan vt 1-1 PubChem CID: 23963 ChEBI: CHEBI:33341 IUPAC Name: titanium SMILES: [Ti]
| PubChem CID | 23963 |
|---|---|
| CAS | 7440-32-6 |
| Molecular Weight (g/mol) | 47.87 |
| ChEBI | CHEBI:33341 |
| MDL Number | MFCD00011264,MFCD00151301 |
| SMILES | [Ti] |
| Synonym | oremet,alloy,cp,vt1,c.p.,contimet 30,jistp28,titanium-125,ii hydride,titan vt 1-1 |
| IUPAC Name | titanium |
| InChI Key | RTAQQCXQSZGOHL-UHFFFAOYSA-N |
| Molecular Formula | Ti |
Tin(IV) oxide, 99.9%, (trace metal basis)
CAS: 18282-10-5 Molecular Formula: O2Sn Molecular Weight (g/mol): 150.71 MDL Number: MFCD00011244 InChI Key: XOLBLPGZBRYERU-UHFFFAOYSA-N Synonym: tin dioxide,tin iv oxide,stannic oxide,cassiterite,flowers of tin,stannic dioxide,tin oxide sno2,tin peroxide,white tin oxide,stannic anhydride PubChem CID: 29011 ChEBI: CHEBI:52991 IUPAC Name: stannanedione SMILES: O=[Sn]=O
| PubChem CID | 29011 |
|---|---|
| CAS | 18282-10-5 |
| Molecular Weight (g/mol) | 150.71 |
| ChEBI | CHEBI:52991 |
| MDL Number | MFCD00011244 |
| SMILES | O=[Sn]=O |
| Synonym | tin dioxide,tin iv oxide,stannic oxide,cassiterite,flowers of tin,stannic dioxide,tin oxide sno2,tin peroxide,white tin oxide,stannic anhydride |
| IUPAC Name | stannanedione |
| InChI Key | XOLBLPGZBRYERU-UHFFFAOYSA-N |
| Molecular Formula | O2Sn |
Copper powder, -150 mesh, 99.5% (metals basis)
CAS: 7440-50-8 Molecular Formula: Cu Molecular Weight (g/mol): 63.55 MDL Number: MFCD00010965 InChI Key: RYGMFSIKBFXOCR-UHFFFAOYSA-N Synonym: cuprum,cobre,cuivre,blister,cathode,bronze,powder,anode,precipitates,kupfer PubChem CID: 23978 ChEBI: CHEBI:30052 IUPAC Name: copper SMILES: [Cu]
| PubChem CID | 23978 |
|---|---|
| CAS | 7440-50-8 |
| Molecular Weight (g/mol) | 63.55 |
| ChEBI | CHEBI:30052 |
| MDL Number | MFCD00010965 |
| SMILES | [Cu] |
| Synonym | cuprum,cobre,cuivre,blister,cathode,bronze,powder,anode,precipitates,kupfer |
| IUPAC Name | copper |
| InChI Key | RYGMFSIKBFXOCR-UHFFFAOYSA-N |
| Molecular Formula | Cu |
Lead(II) carbonate, ACS
CAS: 598-63-0 Molecular Formula: CO3Pb Molecular Weight (g/mol): 267.20 MDL Number: MFCD00064631 InChI Key: MFEVGQHCNVXMER-UHFFFAOYSA-L Synonym: lead carbonate,lead ii carbonate,cerussete,cerussite,lead 2+ carbonate,plumbous carbonate,dibasic lead carbonate,unii-43m0p24l2b,carbonic acid, lead 2+ salt 1:1,lead carbonate pbco3 PubChem CID: 11727 SMILES: [Pb++].[O-]C([O-])=O
| PubChem CID | 11727 |
|---|---|
| CAS | 598-63-0 |
| Molecular Weight (g/mol) | 267.20 |
| MDL Number | MFCD00064631 |
| SMILES | [Pb++].[O-]C([O-])=O |
| Synonym | lead carbonate,lead ii carbonate,cerussete,cerussite,lead 2+ carbonate,plumbous carbonate,dibasic lead carbonate,unii-43m0p24l2b,carbonic acid, lead 2+ salt 1:1,lead carbonate pbco3 |
| InChI Key | MFEVGQHCNVXMER-UHFFFAOYSA-L |
| Molecular Formula | CO3Pb |
Zinc acetate dihydrate, 98%, extra pure
CAS: 5970-45-6 Molecular Formula: C4H6O4Zn·2H2O Molecular Weight (g/mol): 219.5 MDL Number: MFCD00066961 InChI Key: BEAZKUGSCHFXIQ-UHFFFAOYSA-L Synonym: zinc acetate dihydrate,zinc diacetate dihydrate,zinc ii acetate dihydrate,unii-fm5526k07a,acetic acid zinc salt,zinc acetate usp,acetic acid, zinc salt, dihydrate,zinc acetate, dihydrate,galzin tn PubChem CID: 2724192 IUPAC Name: zinc;diacetate;dihydrate SMILES: CC(=O)[O-].CC(=O)[O-].O.O.[Zn+2]
| PubChem CID | 2724192 |
|---|---|
| CAS | 5970-45-6 |
| Molecular Weight (g/mol) | 219.5 |
| MDL Number | MFCD00066961 |
| SMILES | CC(=O)[O-].CC(=O)[O-].O.O.[Zn+2] |
| Synonym | zinc acetate dihydrate,zinc diacetate dihydrate,zinc ii acetate dihydrate,unii-fm5526k07a,acetic acid zinc salt,zinc acetate usp,acetic acid, zinc salt, dihydrate,zinc acetate, dihydrate,galzin tn |
| IUPAC Name | zinc;diacetate;dihydrate |
| InChI Key | BEAZKUGSCHFXIQ-UHFFFAOYSA-L |
| Molecular Formula | C4H6O4Zn·2H2O |
Ferrous Sulfate Heptahydrate, >99%, MP Biomedicals
CAS: 7782-63-0 Molecular Formula: FeH14O11S Molecular Weight (g/mol): 278.01 MDL Number: MFCD00149719 InChI Key: SURQXAFEQWPFPV-UHFFFAOYSA-L Synonym: iron ii sulfate heptahydrate,ferrous sulfate heptahydrate,presfersul,melanterite mineral,iron sulfate heptahydrate,iron 2+ sulfate heptahydrate,fesofor,fesotyme,haemofort,ironate PubChem CID: 62662 ChEBI: CHEBI:75836 IUPAC Name: λ²-iron(2+) heptahydrate sulfate SMILES: O.O.O.O.O.O.O.[Fe++].[O-]S([O-])(=O)=O
| PubChem CID | 62662 |
|---|---|
| CAS | 7782-63-0 |
| Molecular Weight (g/mol) | 278.01 |
| ChEBI | CHEBI:75836 |
| MDL Number | MFCD00149719 |
| SMILES | O.O.O.O.O.O.O.[Fe++].[O-]S([O-])(=O)=O |
| Synonym | iron ii sulfate heptahydrate,ferrous sulfate heptahydrate,presfersul,melanterite mineral,iron sulfate heptahydrate,iron 2+ sulfate heptahydrate,fesofor,fesotyme,haemofort,ironate |
| IUPAC Name | λ²-iron(2+) heptahydrate sulfate |
| InChI Key | SURQXAFEQWPFPV-UHFFFAOYSA-L |
| Molecular Formula | FeH14O11S |
Manganese(II) sulfate monohydrate, ACS, 98.0-101.0%
CAS: 10034-96-5 Molecular Formula: H2MnO5S Molecular Weight (g/mol): 169.01 MDL Number: MFCD00149159 InChI Key: ISPYRSDWRDQNSW-UHFFFAOYSA-L Synonym: manganese sulfate monohydrate,manganese ii sulfate monohydrate,manganese sulfate hydrate,manganese ii sulfate hydrate,mnso4.h2o,manganous sulfate monohydrate,unii-w00lys4t26,manganese 2+ sulfate monohydrate,manganese sulfate usp,manganese 2+ sulfate hydrate PubChem CID: 177577 ChEBI: CHEBI:86364 IUPAC Name: manganese(2+);sulfate;hydrate SMILES: O.[Mn++].[O-]S([O-])(=O)=O
| PubChem CID | 177577 |
|---|---|
| CAS | 10034-96-5 |
| Molecular Weight (g/mol) | 169.01 |
| ChEBI | CHEBI:86364 |
| MDL Number | MFCD00149159 |
| SMILES | O.[Mn++].[O-]S([O-])(=O)=O |
| Synonym | manganese sulfate monohydrate,manganese ii sulfate monohydrate,manganese sulfate hydrate,manganese ii sulfate hydrate,mnso4.h2o,manganous sulfate monohydrate,unii-w00lys4t26,manganese 2+ sulfate monohydrate,manganese sulfate usp,manganese 2+ sulfate hydrate |
| IUPAC Name | manganese(2+);sulfate;hydrate |
| InChI Key | ISPYRSDWRDQNSW-UHFFFAOYSA-L |
| Molecular Formula | H2MnO5S |